C24H25FN2O2S — CID 19495079
4-[(2-fluorophenoxy)methyl]-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-carboxamide (PubChem CID 19495079) has the molecular formula C24H25FN2O2S and a molecular weight of 424.54 g/mol. Its IUPAC name is 4-[(2-fluorophenoxy)methyl]-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 4-[(2-fluorophenoxy)methyl]-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19495079 |
| Molecular Formula | C24H25FN2O2S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-[(2-fluorophenoxy)methyl]-N-[4-(piperidin-1-ylmethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc(CN2CCCCC2)cc1)c1cc(COc2ccccc2F)cs1 |
| InChI | InChI=1S/C24H25FN2O2S/c25-21-6-2-3-7-22(21)29-16-19-14-23(30-17-19)24(28)26-20-10-8-18(9-11-20)15-27-12-4-1-5-13-27/h2-3,6-11,14,17H,1,4-5,12-13,15-16H2,(H,26,28) |
| InChIKey | CSISFXMYHOKBRU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |