C25H26ClN3O2 — CID 85470727
4-chloro-3-phenylmethoxy-N-[3-(piperazin-1-ylmethyl)phenyl]benzamide (PubChem CID 85470727) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 4-chloro-3-phenylmethoxy-N-[3-(piperazin-1-ylmethyl)phenyl]benzamide.
| Compound Name | 4-chloro-3-phenylmethoxy-N-[3-(piperazin-1-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 85470727 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-chloro-3-phenylmethoxy-N-[3-(piperazin-1-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CN2CCNCC2)c1)c1ccc(Cl)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C25H26ClN3O2/c26-23-10-9-21(16-24(23)31-18-19-5-2-1-3-6-19)25(30)28-22-8-4-7-20(15-22)17-29-13-11-27-12-14-29/h1-10,15-16,27H,11-14,17-18H2,(H,28,30) |
| InChIKey | PIFYQCZGEPXXNQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |