C22H27ClN4O — CID 120967927
2-chloro-N-[3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]phenyl]benzamide (PubChem CID 120967927) has the molecular formula C22H27ClN4O and a molecular weight of 398.94 g/mol. Its IUPAC name is 2-chloro-N-[3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 120967927 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 2-chloro-N-[3-[(3-piperazin-1-ylpyrrolidin-1-yl)methyl]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CN2CCC(N3CCNCC3)C2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C22H27ClN4O/c23-21-7-2-1-6-20(21)22(28)25-18-5-3-4-17(14-18)15-26-11-8-19(16-26)27-12-9-24-10-13-27/h1-7,14,19,24H,8-13,15-16H2,(H,25,28) |
| InChIKey | BTVSKCLWXVKJQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |