C20H24ClN3O — CID 120905897
2-chloro-N-[3-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]benzamide (PubChem CID 120905897) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 2-chloro-N-[3-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 120905897 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-chloro-N-[3-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]benzamide |
| SMILES | CC1CN(Cc2cccc(NC(=O)c3ccccc3Cl)c2)C(C)CN1 |
| InChI | InChI=1S/C20H24ClN3O/c1-14-12-24(15(2)11-22-14)13-16-6-5-7-17(10-16)23-20(25)18-8-3-4-9-19(18)21/h3-10,14-15,22H,11-13H2,1-2H3,(H,23,25) |
| InChIKey | DXUCWQIUMCDJEX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |