C19H19ClN2O3 — CID 122038743
(2S)-1-[[3-[(2-chlorobenzoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 122038743) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is (2S)-1-[[3-[(2-chlorobenzoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[[3-[(2-chlorobenzoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 122038743 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | (2S)-1-[[3-[(2-chlorobenzoyl)amino]phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(Nc1cccc(CN2CCC[C@H]2C(=O)O)c1)c1ccccc1Cl |
| InChI | InChI=1S/C19H19ClN2O3/c20-16-8-2-1-7-15(16)18(23)21-14-6-3-5-13(11-14)12-22-10-4-9-17(22)19(24)25/h1-3,5-8,11,17H,4,9-10,12H2,(H,21,23)(H,24,25)/t17-/m0/s1 |
| InChIKey | BBGWXKSLGYDMDQ-KRWDZBQOSA-N |
| XLogP | 3.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |