C22H26ClN3O — CID 120906565
2-chloro-N-[3-(2,8-diazaspiro[4.5]decan-2-ylmethyl)phenyl]benzamide (PubChem CID 120906565) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 2-chloro-N-[3-(2,8-diazaspiro[4.5]decan-2-ylmethyl)phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-(2,8-diazaspiro[4.5]decan-2-ylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 120906565 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-chloro-N-[3-(2,8-diazaspiro[4.5]decan-2-ylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CN2CCC3(CCNCC3)C2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C22H26ClN3O/c23-20-7-2-1-6-19(20)21(27)25-18-5-3-4-17(14-18)15-26-13-10-22(16-26)8-11-24-12-9-22/h1-7,14,24H,8-13,15-16H2,(H,25,27) |
| InChIKey | VXIBKJLSSNHEAO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |