About N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride
N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride (PubChem CID 120905888) has the molecular formula C15H24ClN3O
and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride |
| PubChem CID | 120905888 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(CN2CC(C)NCC2C)cc1.Cl |
| InChI | InChI=1S/C15H23N3O.ClH/c1-11-9-18(12(2)8-16-11)10-14-4-6-15(7-5-14)17-13(3)19;/h4-7,11-12,16H,8-10H2,1-3H3,(H,17,19);1H |
| InChIKey | BFZWXAYRJNFLPA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride?
The IUPAC name of N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride (CID 120905888) is N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride.
What is the SMILES notation for N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride?
The canonical SMILES for N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride is CC(=O)Nc1ccc(CN2CC(C)NCC2C)cc1.Cl.
What is the InChIKey of N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride?
The InChIKey is BFZWXAYRJNFLPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O.ClH/c1-11-9-18(12(2)8-16-11)10-14-4-6-15(7-5-14)17-13(3)19;/h4-7,11-12,16H,8-10H2,1-3H3,(H,17,19);1H.
What are the key properties of N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride?
N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride has a molecular weight of 297.83 g/mol, XLogP of 2.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(2,5-dimethylpiperazin-1-yl)methyl]phenyl]acetamide;hydrochloride is sourced from PubChem (CID 120905888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).