C15H21ClN4O2 — CID 120968007
1-[1-[(3-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120968007) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 1-[1-[(3-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[(3-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120968007 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[1-[(3-chloro-4-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(CN2CCC(N3CCNCC3)C2)cc1Cl |
| InChI | InChI=1S/C15H21ClN4O2/c16-14-9-12(1-2-15(14)20(21)22)10-18-6-3-13(11-18)19-7-4-17-5-8-19/h1-2,9,13,17H,3-8,10-11H2 |
| InChIKey | QKYHVAALNGIAOA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|