C16H23Cl2N3O2 — CID 120841447
1-[(3-chloro-4-nitrophenyl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine;hydrochloride (PubChem CID 120841447) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 1-[(3-chloro-4-nitrophenyl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine;hydrochloride.
| Compound Name | 1-[(3-chloro-4-nitrophenyl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120841447 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 1-[(3-chloro-4-nitrophenyl)methyl]-N-(cyclopropylmethyl)piperidin-4-amine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(CN2CCC(NCC3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C16H22ClN3O2.ClH/c17-15-9-13(3-4-16(15)20(21)22)11-19-7-5-14(6-8-19)18-10-12-1-2-12;/h3-4,9,12,14,18H,1-2,5-8,10-11H2;1H |
| InChIKey | WECGOGSEVPOEAW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|