C14H21Cl2N3O2 — CID 120838115
1-[1-[(3-chloro-4-nitrophenyl)methyl]piperidin-4-yl]ethanamine;hydrochloride (PubChem CID 120838115) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is 1-[1-[(3-chloro-4-nitrophenyl)methyl]piperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-[(3-chloro-4-nitrophenyl)methyl]piperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 120838115 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[1-[(3-chloro-4-nitrophenyl)methyl]piperidin-4-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCN(Cc2ccc([N+](=O)[O-])c(Cl)c2)CC1.Cl |
| InChI | InChI=1S/C14H20ClN3O2.ClH/c1-10(16)12-4-6-17(7-5-12)9-11-2-3-14(18(19)20)13(15)8-11;/h2-3,8,10,12H,4-7,9,16H2,1H3;1H |
| InChIKey | SPEGUACUFQKKPS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|