C17H21ClN4O3 — CID 86791745
2-[[4-[(3-chloro-4-nitrophenyl)methyl]piperazin-1-yl]methyl]-4,5-dimethyl-1,3-oxazole (PubChem CID 86791745) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 2-[[4-[(3-chloro-4-nitrophenyl)methyl]piperazin-1-yl]methyl]-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-[[4-[(3-chloro-4-nitrophenyl)methyl]piperazin-1-yl]methyl]-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 86791745 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[[4-[(3-chloro-4-nitrophenyl)methyl]piperazin-1-yl]methyl]-4,5-dimethyl-1,3-oxazole |
| SMILES | Cc1nc(CN2CCN(Cc3ccc([N+](=O)[O-])c(Cl)c3)CC2)oc1C |
| InChI | InChI=1S/C17H21ClN4O3/c1-12-13(2)25-17(19-12)11-21-7-5-20(6-8-21)10-14-3-4-16(22(23)24)15(18)9-14/h3-4,9H,5-8,10-11H2,1-2H3 |
| InChIKey | CLDVCYDIGBGYLA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|