C13H18ClN3O2 — CID 63610531
4-[(4-chloro-3-nitrophenyl)methyl]-1,2-dimethylpiperazine (PubChem CID 63610531) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-[(4-chloro-3-nitrophenyl)methyl]-1,2-dimethylpiperazine.
| Compound Name | 4-[(4-chloro-3-nitrophenyl)methyl]-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 63610531 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[(4-chloro-3-nitrophenyl)methyl]-1,2-dimethylpiperazine |
| SMILES | CC1CN(Cc2ccc(Cl)c([N+](=O)[O-])c2)CCN1C |
| InChI | InChI=1S/C13H18ClN3O2/c1-10-8-16(6-5-15(10)2)9-11-3-4-12(14)13(7-11)17(18)19/h3-4,7,10H,5-6,8-9H2,1-2H3 |
| InChIKey | ZUVUWJBKHMSVKM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|