C13H21N5O2 — CID 63634928
[4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-nitrophenyl]hydrazine (PubChem CID 63634928) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is [4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-nitrophenyl]hydrazine.
| Compound Name | [4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-nitrophenyl]hydrazine |
|---|---|
| PubChem CID | 63634928 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | [4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-nitrophenyl]hydrazine |
| SMILES | CC1CN(Cc2ccc(NN)c([N+](=O)[O-])c2)CCN1C |
| InChI | InChI=1S/C13H21N5O2/c1-10-8-17(6-5-16(10)2)9-11-3-4-12(15-14)13(7-11)18(19)20/h3-4,7,10,15H,5-6,8-9,14H2,1-2H3 |
| InChIKey | SBOLXUUQVDLIGA-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|