C14H23N3 — CID 63621224
4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-methylaniline (PubChem CID 63621224) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-methylaniline.
| Compound Name | 4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 63621224 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4-[(3,4-dimethylpiperazin-1-yl)methyl]-2-methylaniline |
| SMILES | Cc1cc(CN2CCN(C)C(C)C2)ccc1N |
| InChI | InChI=1S/C14H23N3/c1-11-8-13(4-5-14(11)15)10-17-7-6-16(3)12(2)9-17/h4-5,8,12H,6-7,9-10,15H2,1-3H3 |
| InChIKey | PAWQKIYBGIFBRW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|