C14H18FN3 — CID 103865064
5-[(3,4-dimethylpiperazin-1-yl)methyl]-2-fluorobenzonitrile (PubChem CID 103865064) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 5-[(3,4-dimethylpiperazin-1-yl)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(3,4-dimethylpiperazin-1-yl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103865064 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 5-[(3,4-dimethylpiperazin-1-yl)methyl]-2-fluorobenzonitrile |
| SMILES | CC1CN(Cc2ccc(F)c(C#N)c2)CCN1C |
| InChI | InChI=1S/C14H18FN3/c1-11-9-18(6-5-17(11)2)10-12-3-4-14(15)13(7-12)8-16/h3-4,7,11H,5-6,9-10H2,1-2H3 |
| InChIKey | DBNVADXTBSIETB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |