C16H19FN4 — CID 107881011
5-[[4-(2-cyanopropan-2-yl)piperazin-1-yl]methyl]-2-fluorobenzonitrile (PubChem CID 107881011) has the molecular formula C16H19FN4 and a molecular weight of 286.35 g/mol. Its IUPAC name is 5-[[4-(2-cyanopropan-2-yl)piperazin-1-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[4-(2-cyanopropan-2-yl)piperazin-1-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107881011 |
| Molecular Formula | C16H19FN4 |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 5-[[4-(2-cyanopropan-2-yl)piperazin-1-yl]methyl]-2-fluorobenzonitrile |
| SMILES | CC(C)(C#N)N1CCN(Cc2ccc(F)c(C#N)c2)CC1 |
| InChI | InChI=1S/C16H19FN4/c1-16(2,12-19)21-7-5-20(6-8-21)11-13-3-4-15(17)14(9-13)10-18/h3-4,9H,5-8,11H2,1-2H3 |
| InChIKey | NJVWUUKBJPRXKI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |