C13H15FN2O — CID 103758445
2-fluoro-5-(1,4-oxazepan-4-ylmethyl)benzonitrile (PubChem CID 103758445) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-fluoro-5-(1,4-oxazepan-4-ylmethyl)benzonitrile.
| Compound Name | 2-fluoro-5-(1,4-oxazepan-4-ylmethyl)benzonitrile |
|---|---|
| PubChem CID | 103758445 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-fluoro-5-(1,4-oxazepan-4-ylmethyl)benzonitrile |
| SMILES | N#Cc1cc(CN2CCCOCC2)ccc1F |
| InChI | InChI=1S/C13H15FN2O/c14-13-3-2-11(8-12(13)9-15)10-16-4-1-6-17-7-5-16/h2-3,8H,1,4-7,10H2 |
| InChIKey | NPBDOVKAGOZIAB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |