C16H20FN3O — CID 124806860
5-[[(4aR,8aR)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]methyl]-2-fluorobenzonitrile (PubChem CID 124806860) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 5-[[(4aR,8aR)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(4aR,8aR)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 124806860 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 5-[[(4aR,8aR)-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]methyl]-2-fluorobenzonitrile |
| SMILES | CN1CCO[C@@H]2CCN(Cc3ccc(F)c(C#N)c3)C[C@H]21 |
| InChI | InChI=1S/C16H20FN3O/c1-19-6-7-21-16-4-5-20(11-15(16)19)10-12-2-3-14(17)13(8-12)9-18/h2-3,8,15-16H,4-7,10-11H2,1H3/t15-,16-/m1/s1 |
| InChIKey | BSOGBLHXYBOXOT-HZPDHXFCSA-N |
| XLogP | 1.60 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |