C16H18FN3O — CID 107881893
2-fluoro-5-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]benzonitrile (PubChem CID 107881893) has the molecular formula C16H18FN3O and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-fluoro-5-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 107881893 |
| Molecular Formula | C16H18FN3O |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 2-fluoro-5-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]benzonitrile |
| SMILES | N#Cc1cc(CN2CCC3NC(=O)CCC3C2)ccc1F |
| InChI | InChI=1S/C16H18FN3O/c17-14-3-1-11(7-13(14)8-18)9-20-6-5-15-12(10-20)2-4-16(21)19-15/h1,3,7,12,15H,2,4-6,9-10H2,(H,19,21) |
| InChIKey | PXHPVIAKVCCYIJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |