C13H11FN2O2 — CID 107881969
5-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzonitrile (PubChem CID 107881969) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is 5-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107881969 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CN2C(=O)CCCC2=O)ccc1F |
| InChI | InChI=1S/C13H11FN2O2/c14-11-5-4-9(6-10(11)7-15)8-16-12(17)2-1-3-13(16)18/h4-6H,1-3,8H2 |
| InChIKey | OONGGLHPNDTTFU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|