C13H10FN3O2 — CID 107881999
2-fluoro-5-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzonitrile (PubChem CID 107881999) has the molecular formula C13H10FN3O2 and a molecular weight of 259.24 g/mol. Its IUPAC name is 2-fluoro-5-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 107881999 |
| Molecular Formula | C13H10FN3O2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-fluoro-5-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]benzonitrile |
| SMILES | Cn1ccn(Cc2ccc(F)c(C#N)c2)c(=O)c1=O |
| InChI | InChI=1S/C13H10FN3O2/c1-16-4-5-17(13(19)12(16)18)8-9-2-3-11(14)10(6-9)7-15/h2-6H,8H2,1H3 |
| InChIKey | XILBIMDWVYJBIH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|