C11H8FN3O2 — CID 107881941
5-[(2,5-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile (PubChem CID 107881941) has the molecular formula C11H8FN3O2 and a molecular weight of 233.20 g/mol. Its IUPAC name is 5-[(2,5-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2,5-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107881941 |
| Molecular Formula | C11H8FN3O2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-[(2,5-dioxoimidazolidin-1-yl)methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CN2C(=O)CNC2=O)ccc1F |
| InChI | InChI=1S/C11H8FN3O2/c12-9-2-1-7(3-8(9)4-13)6-15-10(16)5-14-11(15)17/h1-3H,5-6H2,(H,14,17) |
| InChIKey | JATGIBWOKRQVME-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|