C12H9FN2O2S — CID 107882256
5-[(2,4-dioxo-1,3-thiazinan-3-yl)methyl]-2-fluorobenzonitrile (PubChem CID 107882256) has the molecular formula C12H9FN2O2S and a molecular weight of 264.28 g/mol. Its IUPAC name is 5-[(2,4-dioxo-1,3-thiazinan-3-yl)methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[(2,4-dioxo-1,3-thiazinan-3-yl)methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 107882256 |
| Molecular Formula | C12H9FN2O2S |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 5-[(2,4-dioxo-1,3-thiazinan-3-yl)methyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CN2C(=O)CCSC2=O)ccc1F |
| InChI | InChI=1S/C12H9FN2O2S/c13-10-2-1-8(5-9(10)6-14)7-15-11(16)3-4-18-12(15)17/h1-2,5H,3-4,7H2 |
| InChIKey | PUCORIOMNLYELE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|