C11H10ClNO2S — CID 19838636
3-[(4-chlorophenyl)methyl]-1,3-thiazinane-2,4-dione (PubChem CID 19838636) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-1,3-thiazinane-2,4-dione.
| Compound Name | 3-[(4-chlorophenyl)methyl]-1,3-thiazinane-2,4-dione |
|---|---|
| PubChem CID | 19838636 |
| Molecular Formula | C11H10ClNO2S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-1,3-thiazinane-2,4-dione |
| SMILES | O=C1CCSC(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H10ClNO2S/c12-9-3-1-8(2-4-9)7-13-10(14)5-6-16-11(13)15/h1-4H,5-7H2 |
| InChIKey | AMQQETHLJCRMNY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|