C18H13ClFN2OPS — CID 164874018
7-(1,3-azaphosphet-2-yl)-5-[(4-chlorophenyl)methyl]-8-fluoro-2,3-dihydro-1,5-benzothiazepin-4-one (PubChem CID 164874018) has the molecular formula C18H13ClFN2OPS and a molecular weight of 390.81 g/mol. Its IUPAC name is 7-(1,3-azaphosphet-2-yl)-5-[(4-chlorophenyl)methyl]-8-fluoro-2,3-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 7-(1,3-azaphosphet-2-yl)-5-[(4-chlorophenyl)methyl]-8-fluoro-2,3-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 164874018 |
| Molecular Formula | C18H13ClFN2OPS |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 7-(1,3-azaphosphet-2-yl)-5-[(4-chlorophenyl)methyl]-8-fluoro-2,3-dihydro-1,5-benzothiazepin-4-one |
| SMILES | O=C1CCSc2cc(F)c(C3=PC=N3)cc2N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClFN2OPS/c19-12-3-1-11(2-4-12)9-22-15-7-13(18-21-10-24-18)14(20)8-16(15)25-6-5-17(22)23/h1-4,7-8,10H,5-6,9H2 |
| InChIKey | OLHZMLLUJYHORC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|