C15H18FN3O3S — CID 129485083
5-[[(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]sulfonyl]-2-fluorobenzonitrile (PubChem CID 129485083) has the molecular formula C15H18FN3O3S and a molecular weight of 339.39 g/mol. Its IUPAC name is 5-[[(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]sulfonyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]sulfonyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 129485083 |
| Molecular Formula | C15H18FN3O3S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-[[(4aR,8aR)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-4-yl]sulfonyl]-2-fluorobenzonitrile |
| SMILES | CN1CC[C@H]2OCCN(S(=O)(=O)c3ccc(F)c(C#N)c3)[C@@H]2C1 |
| InChI | InChI=1S/C15H18FN3O3S/c1-18-5-4-15-14(10-18)19(6-7-22-15)23(20,21)12-2-3-13(16)11(8-12)9-17/h2-3,8,14-15H,4-7,10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ORUYGPKLOKPPRV-HUUCEWRRSA-N |
| XLogP | 0.79 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |