C16H24N4O2 — CID 120968332
1-[1-[(4-methyl-3-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120968332) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[1-[(4-methyl-3-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[(4-methyl-3-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120968332 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1-[1-[(4-methyl-3-nitrophenyl)methyl]pyrrolidin-3-yl]piperazine |
| SMILES | Cc1ccc(CN2CCC(N3CCNCC3)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N4O2/c1-13-2-3-14(10-16(13)20(21)22)11-18-7-4-15(12-18)19-8-5-17-6-9-19/h2-3,10,15,17H,4-9,11-12H2,1H3 |
| InChIKey | WRBRRBSBVDKNSR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|