C18H29ClN4O2 — CID 120967908
1-[1-[(3-nitro-4-propan-2-ylphenyl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride (PubChem CID 120967908) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 1-[1-[(3-nitro-4-propan-2-ylphenyl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride.
| Compound Name | 1-[1-[(3-nitro-4-propan-2-ylphenyl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120967908 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[1-[(3-nitro-4-propan-2-ylphenyl)methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
| SMILES | CC(C)c1ccc(CN2CCC(N3CCNCC3)C2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C18H28N4O2.ClH/c1-14(2)17-4-3-15(11-18(17)22(23)24)12-20-8-5-16(13-20)21-9-6-19-7-10-21;/h3-4,11,14,16,19H,5-10,12-13H2,1-2H3;1H |
| InChIKey | AUAGFPXQZGMIOT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|