C19H27ClN6O2 — CID 120967804
1-[1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride (PubChem CID 120967804) has the molecular formula C19H27ClN6O2 and a molecular weight of 406.92 g/mol. Its IUPAC name is 1-[1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride.
| Compound Name | 1-[1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120967804 |
| Molecular Formula | C19H27ClN6O2 |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 1-[1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]pyrrolidin-3-yl]piperazine;hydrochloride |
| SMILES | Cl.Cn1cc(CN2CCC(N3CCNCC3)C2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H26N6O2.ClH/c1-22-12-16(19(21-22)15-2-4-17(5-3-15)25(26)27)13-23-9-6-18(14-23)24-10-7-20-8-11-24;/h2-5,12,18,20H,6-11,13-14H2,1H3;1H |
| InChIKey | OWSCAPBJSYCCHQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|