C18H27ClN4O3 — CID 120995254
2-methyl-2-(4-nitrophenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride (PubChem CID 120995254) has the molecular formula C18H27ClN4O3 and a molecular weight of 382.89 g/mol. Its IUPAC name is 2-methyl-2-(4-nitrophenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 2-methyl-2-(4-nitrophenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120995254 |
| Molecular Formula | C18H27ClN4O3 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-methyl-2-(4-nitrophenyl)-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one;hydrochloride |
| SMILES | CC(C)(C(=O)N1CCC(N2CCNCC2)C1)c1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C18H26N4O3.ClH/c1-18(2,14-3-5-15(6-4-14)22(24)25)17(23)21-10-7-16(13-21)20-11-8-19-9-12-20;/h3-6,16,19H,7-13H2,1-2H3;1H |
| InChIKey | FERXAUFDBXBVFH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|