C18H25N5O2 — CID 120782169
3,3-dimethyl-1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]piperidin-4-amine (PubChem CID 120782169) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3,3-dimethyl-1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]piperidin-4-amine.
| Compound Name | 3,3-dimethyl-1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 120782169 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 3,3-dimethyl-1-[[1-methyl-3-(4-nitrophenyl)pyrazol-4-yl]methyl]piperidin-4-amine |
| SMILES | Cn1cc(CN2CCC(N)C(C)(C)C2)c(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H25N5O2/c1-18(2)12-22(9-8-16(18)19)11-14-10-21(3)20-17(14)13-4-6-15(7-5-13)23(24)25/h4-7,10,16H,8-9,11-12,19H2,1-3H3 |
| InChIKey | HEKOFZKTFHQZOS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|