C17H28ClN3O3 — CID 120776219
3,3-dimethyl-1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]piperidin-4-amine;hydrochloride (PubChem CID 120776219) has the molecular formula C17H28ClN3O3 and a molecular weight of 357.88 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]piperidin-4-amine;hydrochloride.
| Compound Name | 3,3-dimethyl-1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120776219 |
| Molecular Formula | C17H28ClN3O3 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3,3-dimethyl-1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]piperidin-4-amine;hydrochloride |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1CN1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C17H27N3O3.ClH/c1-12(2)23-15-6-5-14(20(21)22)9-13(15)10-19-8-7-16(18)17(3,4)11-19;/h5-6,9,12,16H,7-8,10-11,18H2,1-4H3;1H |
| InChIKey | KJYLXUDSNNYTNS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|