C17H26N2O4 — CID 111103059
3-[1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]pyrrolidin-2-yl]propan-1-ol (PubChem CID 111103059) has the molecular formula C17H26N2O4 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-[1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]pyrrolidin-2-yl]propan-1-ol.
| Compound Name | 3-[1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]pyrrolidin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 111103059 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-[1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]pyrrolidin-2-yl]propan-1-ol |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1CN1CCCC1CCCO |
| InChI | InChI=1S/C17H26N2O4/c1-13(2)23-17-8-7-16(19(21)22)11-14(17)12-18-9-3-5-15(18)6-4-10-20/h7-8,11,13,15,20H,3-6,9-10,12H2,1-2H3 |
| InChIKey | IBSLLJMXMNXDRF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|