C16H22F2N4O3 — CID 120967839
1-[1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]pyrrolidin-3-yl]piperazine (PubChem CID 120967839) has the molecular formula C16H22F2N4O3 and a molecular weight of 356.37 g/mol. Its IUPAC name is 1-[1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]pyrrolidin-3-yl]piperazine.
| Compound Name | 1-[1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]pyrrolidin-3-yl]piperazine |
|---|---|
| PubChem CID | 120967839 |
| Molecular Formula | C16H22F2N4O3 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]pyrrolidin-3-yl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(OC(F)F)c(CN2CCC(N3CCNCC3)C2)c1 |
| InChI | InChI=1S/C16H22F2N4O3/c17-16(18)25-15-2-1-13(22(23)24)9-12(15)10-20-6-3-14(11-20)21-7-4-19-5-8-21/h1-2,9,14,16,19H,3-8,10-11H2 |
| InChIKey | OWOMNASBONLICT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|