C15H18F2N2O5 — CID 122125433
1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122125433) has the molecular formula C15H18F2N2O5 and a molecular weight of 344.31 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122125433 |
| Molecular Formula | C15H18F2N2O5 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-5-nitrophenyl]methyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(Cc2cc([N+](=O)[O-])ccc2OC(F)F)C1 |
| InChI | InChI=1S/C15H18F2N2O5/c1-9-4-11(14(20)21)8-18(6-9)7-10-5-12(19(22)23)2-3-13(10)24-15(16)17/h2-3,5,9,11,15H,4,6-8H2,1H3,(H,20,21) |
| InChIKey | UYIDRYMNXBNRHA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|