C29H28F2N6O4S — CID 154851819
N-[4-[5-[2-[(3,4-difluorophenyl)methylamino]-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide (PubChem CID 154851819) has the molecular formula C29H28F2N6O4S and a molecular weight of 594.64 g/mol. Its IUPAC name is N-[4-[5-[2-[(3,4-difluorophenyl)methylamino]-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide.
| Compound Name | N-[4-[5-[2-[(3,4-difluorophenyl)methylamino]-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 154851819 |
| Molecular Formula | C29H28F2N6O4S |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | N-[4-[5-[2-[(3,4-difluorophenyl)methylamino]-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
| SMILES | O=C(Cc1nc(-c2ccc(NC(=O)c3cccc(CN4CCS(=O)(=O)CC4)c3)cc2)n[nH]1)NCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C29H28F2N6O4S/c30-24-9-4-19(15-25(24)31)17-32-27(38)16-26-34-28(36-35-26)21-5-7-23(8-6-21)33-29(39)22-3-1-2-20(14-22)18-37-10-12-42(40,41)13-11-37/h1-9,14-15H,10-13,16-18H2,(H,32,38)(H,33,39)(H,34,35,36) |
| InChIKey | CMGULNFHCCWFET-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |