C28H34N6O4S — CID 154851777
N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide (PubChem CID 154851777) has the molecular formula C28H34N6O4S and a molecular weight of 550.69 g/mol. Its IUPAC name is N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide.
| Compound Name | N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 154851777 |
| Molecular Formula | C28H34N6O4S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | N-[4-[5-[2-(cyclohexylamino)-2-oxoethyl]-1H-1,2,4-triazol-3-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
| SMILES | O=C(Cc1nc(-c2ccc(NC(=O)c3cccc(CN4CCS(=O)(=O)CC4)c3)cc2)n[nH]1)NC1CCCCC1 |
| InChI | InChI=1S/C28H34N6O4S/c35-26(29-23-7-2-1-3-8-23)18-25-31-27(33-32-25)21-9-11-24(12-10-21)30-28(36)22-6-4-5-20(17-22)19-34-13-15-39(37,38)16-14-34/h4-6,9-12,17,23H,1-3,7-8,13-16,18-19H2,(H,29,35)(H,30,36)(H,31,32,33) |
| InChIKey | VRXADHSWIORVIH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |