C30H31N5O4S — CID 167856754
N-[4-[3-(2,2-dimethyl-3H-1-benzofuran-5-yl)-1H-1,2,4-triazol-5-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide (PubChem CID 167856754) has the molecular formula C30H31N5O4S and a molecular weight of 557.68 g/mol. Its IUPAC name is N-[4-[3-(2,2-dimethyl-3H-1-benzofuran-5-yl)-1H-1,2,4-triazol-5-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide.
| Compound Name | N-[4-[3-(2,2-dimethyl-3H-1-benzofuran-5-yl)-1H-1,2,4-triazol-5-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 167856754 |
| Molecular Formula | C30H31N5O4S |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | N-[4-[3-(2,2-dimethyl-3H-1-benzofuran-5-yl)-1H-1,2,4-triazol-5-yl]phenyl]-3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]benzamide |
| SMILES | CC1(C)Cc2cc(-c3n[nH]c(-c4ccc(NC(=O)c5cccc(CN6CCS(=O)(=O)CC6)c5)cc4)n3)ccc2O1 |
| InChI | InChI=1S/C30H31N5O4S/c1-30(2)18-24-17-22(8-11-26(24)39-30)28-32-27(33-34-28)21-6-9-25(10-7-21)31-29(36)23-5-3-4-20(16-23)19-35-12-14-40(37,38)15-13-35/h3-11,16-17H,12-15,18-19H2,1-2H3,(H,31,36)(H,32,33,34) |
| InChIKey | GQCSKTOQOHHXDN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |