C30H28N6O3S2 — CID 167935335
3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-[4-[3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]benzamide (PubChem CID 167935335) has the molecular formula C30H28N6O3S2 and a molecular weight of 584.73 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-[4-[3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]benzamide.
| Compound Name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-[4-[3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 167935335 |
| Molecular Formula | C30H28N6O3S2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-N-[4-[3-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-1H-1,2,4-triazol-5-yl]phenyl]benzamide |
| SMILES | Cc1nc(-c2cccc(-c3n[nH]c(-c4ccc(NC(=O)c5cccc(CN6CCS(=O)(=O)CC6)c5)cc4)n3)c2)cs1 |
| InChI | InChI=1S/C30H28N6O3S2/c1-20-31-27(19-40-20)23-5-3-6-24(17-23)29-33-28(34-35-29)22-8-10-26(11-9-22)32-30(37)25-7-2-4-21(16-25)18-36-12-14-41(38,39)15-13-36/h2-11,16-17,19H,12-15,18H2,1H3,(H,32,37)(H,33,34,35) |
| InChIKey | RSSGEPUWXVSUGC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |