C30H21FN2O3S2 — CID 126114247
N-(4-fluorophenyl)-3-[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126114247) has the molecular formula C30H21FN2O3S2 and a molecular weight of 540.64 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-(4-fluorophenyl)-3-[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126114247 |
| Molecular Formula | C30H21FN2O3S2 |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | N-(4-fluorophenyl)-3-[(5E)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(N2C(=O)/C(=C\c3ccccc3OCc3ccccc3)SC2=S)c1 |
| InChI | InChI=1S/C30H21FN2O3S2/c31-23-13-15-24(16-14-23)32-28(34)22-10-6-11-25(17-22)33-29(35)27(38-30(33)37)18-21-9-4-5-12-26(21)36-19-20-7-2-1-3-8-20/h1-18H,19H2,(H,32,34)/b27-18+ |
| InChIKey | YDTRNETWDVDURI-OVVQPSECSA-N |
| XLogP | 7.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|