C24H17FN2O2S3 — CID 126102402
N-(4-fluorophenyl)-3-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126102402) has the molecular formula C24H17FN2O2S3 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-(4-fluorophenyl)-3-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126102402 |
| Molecular Formula | C24H17FN2O2S3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | N-(4-fluorophenyl)-3-[(5E)-5-[(4-methylsulfanylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | CSc1ccc(/C=C2/SC(=S)N(c3cccc(C(=O)Nc4ccc(F)cc4)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H17FN2O2S3/c1-31-20-11-5-15(6-12-20)13-21-23(29)27(24(30)32-21)19-4-2-3-16(14-19)22(28)26-18-9-7-17(25)8-10-18/h2-14H,1H3,(H,26,28)/b21-13+ |
| InChIKey | JJMDJGQDJRFDDT-FYJGNVAPSA-N |
| XLogP | 6.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|