C27H20FN3O2S2 — CID 126114292
3-[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide (PubChem CID 126114292) has the molecular formula C27H20FN3O2S2 and a molecular weight of 501.61 g/mol. Its IUPAC name is 3-[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 126114292 |
| Molecular Formula | C27H20FN3O2S2 |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 3-[(5E)-5-[(1,2-dimethylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
| SMILES | Cc1c(/C=C2/SC(=S)N(c3cccc(C(=O)Nc4ccc(F)cc4)c3)C2=O)c2ccccc2n1C |
| InChI | InChI=1S/C27H20FN3O2S2/c1-16-22(21-8-3-4-9-23(21)30(16)2)15-24-26(33)31(27(34)35-24)20-7-5-6-17(14-20)25(32)29-19-12-10-18(28)11-13-19/h3-15H,1-2H3,(H,29,32)/b24-15+ |
| InChIKey | UMENCZUOTXXPFS-BUVRLJJBSA-N |
| XLogP | 6.28 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|