C36H27FN2O4S2 — CID 126114477
3-[(5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide (PubChem CID 126114477) has the molecular formula C36H27FN2O4S2 and a molecular weight of 634.75 g/mol. Its IUPAC name is 3-[(5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-[(5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 126114477 |
| Molecular Formula | C36H27FN2O4S2 |
| Molecular Weight | 634.75 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | 3-[(5E)-5-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3cccc(C(=O)Nc4ccc(F)cc4)c3)C2=O)ccc1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C36H27FN2O4S2/c1-2-42-32-19-23(13-18-31(32)43-22-26-10-5-8-24-7-3-4-12-30(24)26)20-33-35(41)39(36(44)45-33)29-11-6-9-25(21-29)34(40)38-28-16-14-27(37)15-17-28/h3-21H,2,22H2,1H3,(H,38,40)/b33-20+ |
| InChIKey | VHJBYUHSRJHITE-FMFFXOCNSA-N |
| XLogP | 8.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.75 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|