C33H27FN2O4S2 — CID 126100012
3-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide (PubChem CID 126100012) has the molecular formula C33H27FN2O4S2 and a molecular weight of 598.72 g/mol. Its IUPAC name is 3-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 126100012 |
| Molecular Formula | C33H27FN2O4S2 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 3-[(5E)-5-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)benzamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3cccc(C(=O)Nc4ccc(F)cc4)c3)C2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C33H27FN2O4S2/c1-3-39-29-17-23(11-16-28(29)40-20-22-9-7-21(2)8-10-22)18-30-32(38)36(33(41)42-30)27-6-4-5-24(19-27)31(37)35-26-14-12-25(34)13-15-26/h4-19H,3,20H2,1-2H3,(H,35,37)/b30-18+ |
| InChIKey | AYHDQIOZQPJIFM-UXHLAJHPSA-N |
| XLogP | 7.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|