C20H20N4O2 — CID 50777725
1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea (PubChem CID 50777725) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 50777725 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-(5,6,7,8-tetrahydronaphthalen-1-yl)urea |
| SMILES | Cc1nc(-c2cccc(NC(=O)Nc3cccc4c3CCCC4)c2)no1 |
| InChI | InChI=1S/C20H20N4O2/c1-13-21-19(24-26-13)15-8-4-9-16(12-15)22-20(25)23-18-11-5-7-14-6-2-3-10-17(14)18/h4-5,7-9,11-12H,2-3,6,10H2,1H3,(H2,22,23,25) |
| InChIKey | BGVBUXBAORZYFE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |