C16H20N4O2 — CID 75379397
1-tert-butyl-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]urea (PubChem CID 75379397) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]urea.
| Compound Name | 1-tert-butyl-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 75379397 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-tert-butyl-3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]urea |
| SMILES | CC(C)(C)NC(=O)Nc1cccc(-c2noc(C3CC3)n2)c1 |
| InChI | InChI=1S/C16H20N4O2/c1-16(2,3)19-15(21)17-12-6-4-5-11(9-12)13-18-14(22-20-13)10-7-8-10/h4-6,9-10H,7-8H2,1-3H3,(H2,17,19,21) |
| InChIKey | RGDLMCJIQHDSPD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |