C12H11ClN2O2 — CID 71371451
2-chloro-N-[4-(3-methyl-1,2-oxazol-5-yl)phenyl]acetamide (PubChem CID 71371451) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.69 g/mol. Its IUPAC name is 2-chloro-N-[4-(3-methyl-1,2-oxazol-5-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-(3-methyl-1,2-oxazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 71371451 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-chloro-N-[4-(3-methyl-1,2-oxazol-5-yl)phenyl]acetamide |
| SMILES | Cc1cc(-c2ccc(NC(=O)CCl)cc2)on1 |
| InChI | InChI=1S/C12H11ClN2O2/c1-8-6-11(17-15-8)9-2-4-10(5-3-9)14-12(16)7-13/h2-6H,7H2,1H3,(H,14,16) |
| InChIKey | MAWTVWAEGRJYBS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|