C15H10Cl3N3O — CID 42737754
2-chloro-N-[3-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide (PubChem CID 42737754) has the molecular formula C15H10Cl3N3O and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-chloro-N-[3-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 42737754 |
| Molecular Formula | C15H10Cl3N3O |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 2-chloro-N-[3-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1cccc(-c2cn3cc(Cl)cc(Cl)c3n2)c1 |
| InChI | InChI=1S/C15H10Cl3N3O/c16-6-14(22)19-11-3-1-2-9(4-11)13-8-21-7-10(17)5-12(18)15(21)20-13/h1-5,7-8H,6H2,(H,19,22) |
| InChIKey | AIYXPVPZAIGTHL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|