C18H15Cl2N3OS — CID 5027218
2-chloro-N-[3-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 5027218) has the molecular formula C18H15Cl2N3OS and a molecular weight of 392.31 g/mol. Its IUPAC name is 2-chloro-N-[3-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 5027218 |
| Molecular Formula | C18H15Cl2N3OS |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 2-chloro-N-[3-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | Cc1ccc(Cl)cc1Nc1nc(-c2cccc(NC(=O)CCl)c2)cs1 |
| InChI | InChI=1S/C18H15Cl2N3OS/c1-11-5-6-13(20)8-15(11)22-18-23-16(10-25-18)12-3-2-4-14(7-12)21-17(24)9-19/h2-8,10H,9H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | GHVIRLUDERZXEK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|