C23H17Cl2N3O2S — CID 3654854
N-[3-[2-(2,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]-2-methoxybenzamide (PubChem CID 3654854) has the molecular formula C23H17Cl2N3O2S and a molecular weight of 470.38 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[3-[2-(2,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3654854 |
| Molecular Formula | C23H17Cl2N3O2S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | N-[3-[2-(2,4-dichloroanilino)-1,3-thiazol-4-yl]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1cccc(-c2csc(Nc3ccc(Cl)cc3Cl)n2)c1 |
| InChI | InChI=1S/C23H17Cl2N3O2S/c1-30-21-8-3-2-7-17(21)22(29)26-16-6-4-5-14(11-16)20-13-31-23(28-20)27-19-10-9-15(24)12-18(19)25/h2-13H,1H3,(H,26,29)(H,27,28) |
| InChIKey | LPXRQCVHQATKAL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |